C25H36N2O2PY+ — CID 158602570
[2-(2,6-dimethylanilino)-2-oxoethyl]-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]-diethylphosphanium;yttrium (PubChem CID 158602570) has the molecular formula C25H36N2O2PY+ and a molecular weight of 516.46 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]-diethylphosphanium;yttrium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]-diethylphosphanium;yttrium |
|---|---|
| PubChem CID | 158602570 |
| Molecular Formula | C25H36N2O2PY+ |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]-diethylphosphanium;yttrium |
| SMILES | CC[P+](CC)(CC(=O)Nc1c(C)cccc1C)C(C)C(=O)Nc1c(C)cccc1C.[Y] |
| InChI | InChI=1S/C25H35N2O2P.Y/c1-8-30(9-2,16-22(28)26-23-17(3)12-10-13-18(23)4)21(7)25(29)27-24-19(5)14-11-15-20(24)6;/h10-15,21H,8-9,16H2,1-7H3,(H-,26,27,28,29);/p+1 |
| InChIKey | XGYPOITZWARKEY-UHFFFAOYSA-O |
| XLogP | 5.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|