C12H17NOY — CID 158388394
N-(2,6-dimethylphenyl)-2-methylpropanamide;yttrium (PubChem CID 158388394) has the molecular formula C12H17NOY and a molecular weight of 280.18 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-methylpropanamide;yttrium.
| Compound Name | N-(2,6-dimethylphenyl)-2-methylpropanamide;yttrium |
|---|---|
| PubChem CID | 158388394 |
| Molecular Formula | C12H17NOY |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-methylpropanamide;yttrium |
| SMILES | Cc1cccc(C)c1NC(=O)C(C)C.[Y] |
| InChI | InChI=1S/C12H17NO.Y/c1-8(2)12(14)13-11-9(3)6-5-7-10(11)4;/h5-8H,1-4H3,(H,13,14); |
| InChIKey | SGCVCQZJLYIQGD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |