C18H28NOPY — CID 161387675
CID 161387675 (PubChem CID 161387675) has the molecular formula C18H28NOPY and a molecular weight of 394.31 g/mol.
| Compound Name | CID 161387675 |
|---|---|
| PubChem CID | 161387675 |
| Molecular Formula | C18H28NOPY |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | — |
| SMILES | CC[P+]1(CC(=O)Nc2c(C)cccc2C)[CH-]CCCCC1.[Y] |
| InChI | InChI=1S/C18H28NOP.Y/c1-4-21(12-7-5-6-8-13-21)14-17(20)19-18-15(2)10-9-11-16(18)3;/h9-12H,4-8,13-14H2,1-3H3,(H,19,20); |
| InChIKey | YKNLCZICLTVIPY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|