C27H38N3O2+ — CID 2394747
cycloheptyl-bis[2-(2,6-dimethylanilino)-2-oxoethyl]azanium (PubChem CID 2394747) has the molecular formula C27H38N3O2+ and a molecular weight of 436.62 g/mol. Its IUPAC name is cycloheptyl-bis[2-(2,6-dimethylanilino)-2-oxoethyl]azanium.
| Compound Name | cycloheptyl-bis[2-(2,6-dimethylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2394747 |
| Molecular Formula | C27H38N3O2+ |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | cycloheptyl-bis[2-(2,6-dimethylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1cccc(C)c1NC(=O)C[NH+](CC(=O)Nc1c(C)cccc1C)C1CCCCCC1 |
| InChI | InChI=1S/C27H37N3O2/c1-19-11-9-12-20(2)26(19)28-24(31)17-30(23-15-7-5-6-8-16-23)18-25(32)29-27-21(3)13-10-14-22(27)4/h9-14,23H,5-8,15-18H2,1-4H3,(H,28,31)(H,29,32)/p+1 |
| InChIKey | QYTHFXHEPKSOAJ-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |