C16H25N2O+ — CID 8902222
cyclohexyl-methyl-[2-(2-methylanilino)-2-oxoethyl]azanium (PubChem CID 8902222) has the molecular formula C16H25N2O+ and a molecular weight of 261.39 g/mol. Its IUPAC name is cyclohexyl-methyl-[2-(2-methylanilino)-2-oxoethyl]azanium.
| Compound Name | cyclohexyl-methyl-[2-(2-methylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8902222 |
| Molecular Formula | C16H25N2O+ |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | cyclohexyl-methyl-[2-(2-methylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccccc1NC(=O)C[NH+](C)C1CCCCC1 |
| InChI | InChI=1S/C16H24N2O/c1-13-8-6-7-11-15(13)17-16(19)12-18(2)14-9-4-3-5-10-14/h6-8,11,14H,3-5,9-10,12H2,1-2H3,(H,17,19)/p+1 |
| InChIKey | WAKZCQISEFTWBN-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |