C21H34N3O2+ — CID 8809985
[2-(cyclohexylmethylamino)-2-oxoethyl]-[2-(2-methylanilino)-2-oxoethyl]-propylazanium (PubChem CID 8809985) has the molecular formula C21H34N3O2+ and a molecular weight of 360.52 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl]-[2-(2-methylanilino)-2-oxoethyl]-propylazanium.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl]-[2-(2-methylanilino)-2-oxoethyl]-propylazanium |
|---|---|
| PubChem CID | 8809985 |
| Molecular Formula | C21H34N3O2+ |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl]-[2-(2-methylanilino)-2-oxoethyl]-propylazanium |
| SMILES | CCC[NH+](CC(=O)NCC1CCCCC1)CC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C21H33N3O2/c1-3-13-24(15-20(25)22-14-18-10-5-4-6-11-18)16-21(26)23-19-12-8-7-9-17(19)2/h7-9,12,18H,3-6,10-11,13-16H2,1-2H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | UNXGFWQWRDFAFD-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |