C20H32N3O3+ — CID 9169067
[2-(cyclohexylamino)-2-oxoethyl]-[2-(2-methoxyanilino)-2-oxoethyl]-propylazanium (PubChem CID 9169067) has the molecular formula C20H32N3O3+ and a molecular weight of 362.49 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl]-[2-(2-methoxyanilino)-2-oxoethyl]-propylazanium.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl]-[2-(2-methoxyanilino)-2-oxoethyl]-propylazanium |
|---|---|
| PubChem CID | 9169067 |
| Molecular Formula | C20H32N3O3+ |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl]-[2-(2-methoxyanilino)-2-oxoethyl]-propylazanium |
| SMILES | CCC[NH+](CC(=O)Nc1ccccc1OC)CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H31N3O3/c1-3-13-23(14-19(24)21-16-9-5-4-6-10-16)15-20(25)22-17-11-7-8-12-18(17)26-2/h7-8,11-12,16H,3-6,9-10,13-15H2,1-2H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | JVPICTGQFMJEKE-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |