C22H35N3O3 — CID 27098874
N-cyclooctyl-2-[[2-(2-methoxyanilino)-2-oxoethyl]-propylamino]acetamide (PubChem CID 27098874) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-cyclooctyl-2-[[2-(2-methoxyanilino)-2-oxoethyl]-propylamino]acetamide.
| Compound Name | N-cyclooctyl-2-[[2-(2-methoxyanilino)-2-oxoethyl]-propylamino]acetamide |
|---|---|
| PubChem CID | 27098874 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | N-cyclooctyl-2-[[2-(2-methoxyanilino)-2-oxoethyl]-propylamino]acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1OC)CC(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C22H35N3O3/c1-3-15-25(16-21(26)23-18-11-7-5-4-6-8-12-18)17-22(27)24-19-13-9-10-14-20(19)28-2/h9-10,13-14,18H,3-8,11-12,15-17H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | LKOQWMKWPGTHGD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |