C25H37N3O3 — CID 9168519
N-(1-adamantylmethyl)-2-[[2-(2-methoxyanilino)-2-oxoethyl]-propylamino]acetamide (PubChem CID 9168519) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-[[2-(2-methoxyanilino)-2-oxoethyl]-propylamino]acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-[[2-(2-methoxyanilino)-2-oxoethyl]-propylamino]acetamide |
|---|---|
| PubChem CID | 9168519 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | N-(1-adamantylmethyl)-2-[[2-(2-methoxyanilino)-2-oxoethyl]-propylamino]acetamide |
| SMILES | CCCN(CC(=O)NCC12CC3CC(CC(C3)C1)C2)CC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C25H37N3O3/c1-3-8-28(16-24(30)27-21-6-4-5-7-22(21)31-2)15-23(29)26-17-25-12-18-9-19(13-25)11-20(10-18)14-25/h4-7,18-20H,3,8-17H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | VMJWRAACLSLYBL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |