C22H34N4O3 — CID 56525571
3-[4-(cyclohexylcarbamoylamino)piperidin-1-yl]-N-(2-methoxyphenyl)propanamide (PubChem CID 56525571) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 3-[4-(cyclohexylcarbamoylamino)piperidin-1-yl]-N-(2-methoxyphenyl)propanamide.
| Compound Name | 3-[4-(cyclohexylcarbamoylamino)piperidin-1-yl]-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 56525571 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 3-[4-(cyclohexylcarbamoylamino)piperidin-1-yl]-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)CCN1CCC(NC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C22H34N4O3/c1-29-20-10-6-5-9-19(20)25-21(27)13-16-26-14-11-18(12-15-26)24-22(28)23-17-7-3-2-4-8-17/h5-6,9-10,17-18H,2-4,7-8,11-16H2,1H3,(H,25,27)(H2,23,24,28) |
| InChIKey | KGGAHTGYWMSYHE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |