C17H25N4O4+ — CID 9029443
[2-(cyclopropylcarbamoylamino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 9029443) has the molecular formula C17H25N4O4+ and a molecular weight of 349.41 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9029443 |
| Molecular Formula | C17H25N4O4+ |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC(=O)NC(=O)NC1CC1)CC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C17H24N4O4/c1-3-21(11-16(23)20-17(24)18-12-8-9-12)10-15(22)19-13-6-4-5-7-14(13)25-2/h4-7,12H,3,8-11H2,1-2H3,(H,19,22)(H2,18,20,23,24)/p+1 |
| InChIKey | AJWYYMKHEYGUIB-UHFFFAOYSA-O |
| XLogP | -0.47 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |