C22H29N2O3+ — CID 8810019
(5-acetyl-2-methoxyphenyl)methyl-[2-(2-methylanilino)-2-oxoethyl]-propylazanium (PubChem CID 8810019) has the molecular formula C22H29N2O3+ and a molecular weight of 369.49 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl-[2-(2-methylanilino)-2-oxoethyl]-propylazanium.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl-[2-(2-methylanilino)-2-oxoethyl]-propylazanium |
|---|---|
| PubChem CID | 8810019 |
| Molecular Formula | C22H29N2O3+ |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl-[2-(2-methylanilino)-2-oxoethyl]-propylazanium |
| SMILES | CCC[NH+](CC(=O)Nc1ccccc1C)Cc1cc(C(C)=O)ccc1OC |
| InChI | InChI=1S/C22H28N2O3/c1-5-12-24(15-22(26)23-20-9-7-6-8-16(20)2)14-19-13-18(17(3)25)10-11-21(19)27-4/h6-11,13H,5,12,14-15H2,1-4H3,(H,23,26)/p+1 |
| InChIKey | UWDOGHHVOAWXGU-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |