C20H21BrN2O4 — CID 30867221
2-(5-acetyl-2-methoxyphenyl)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]acetamide (PubChem CID 30867221) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is 2-(5-acetyl-2-methoxyphenyl)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-(5-acetyl-2-methoxyphenyl)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 30867221 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 2-(5-acetyl-2-methoxyphenyl)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]acetamide |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)NCC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C20H21BrN2O4/c1-12-8-16(21)5-6-17(12)23-20(26)11-22-19(25)10-15-9-14(13(2)24)4-7-18(15)27-3/h4-9H,10-11H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | JAPTTWQGRPNANJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |