C24H24N2O4S2 — CID 134097257
(5-acetyl-2-methoxyphenyl)methyl N'-(benzenesulfonyl)-N-(2-methylphenyl)carbamimidothioate (PubChem CID 134097257) has the molecular formula C24H24N2O4S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl N'-(benzenesulfonyl)-N-(2-methylphenyl)carbamimidothioate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl N'-(benzenesulfonyl)-N-(2-methylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 134097257 |
| Molecular Formula | C24H24N2O4S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl N'-(benzenesulfonyl)-N-(2-methylphenyl)carbamimidothioate |
| SMILES | COc1ccc(C(C)=O)cc1CS/C(=N\S(=O)(=O)c1ccccc1)Nc1ccccc1C |
| InChI | InChI=1S/C24H24N2O4S2/c1-17-9-7-8-12-22(17)25-24(26-32(28,29)21-10-5-4-6-11-21)31-16-20-15-19(18(2)27)13-14-23(20)30-3/h4-15H,16H2,1-3H3,(H,25,26) |
| InChIKey | YFNMUNGFGIXIMS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|