C24H34N3O2+ — CID 9104659
cyclohexyl-[[2-[[2-(2-ethoxyanilino)-2-oxoethyl]amino]phenyl]methyl]-methylazanium (PubChem CID 9104659) has the molecular formula C24H34N3O2+ and a molecular weight of 396.56 g/mol. Its IUPAC name is cyclohexyl-[[2-[[2-(2-ethoxyanilino)-2-oxoethyl]amino]phenyl]methyl]-methylazanium.
| Compound Name | cyclohexyl-[[2-[[2-(2-ethoxyanilino)-2-oxoethyl]amino]phenyl]methyl]-methylazanium |
|---|---|
| PubChem CID | 9104659 |
| Molecular Formula | C24H34N3O2+ |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | cyclohexyl-[[2-[[2-(2-ethoxyanilino)-2-oxoethyl]amino]phenyl]methyl]-methylazanium |
| SMILES | CCOc1ccccc1NC(=O)CNc1ccccc1C[NH+](C)C1CCCCC1 |
| InChI | InChI=1S/C24H33N3O2/c1-3-29-23-16-10-9-15-22(23)26-24(28)17-25-21-14-8-7-11-19(21)18-27(2)20-12-5-4-6-13-20/h7-11,14-16,20,25H,3-6,12-13,17-18H2,1-2H3,(H,26,28)/p+1 |
| InChIKey | IMYDBGCBBXGYJE-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |