C22H28ClN4O3+ — CID 2420495
[2-[[2-(2-chloro-5-nitroanilino)-2-oxoethyl]amino]phenyl]methyl-cyclohexyl-methylazanium (PubChem CID 2420495) has the molecular formula C22H28ClN4O3+ and a molecular weight of 431.94 g/mol. Its IUPAC name is [2-[[2-(2-chloro-5-nitroanilino)-2-oxoethyl]amino]phenyl]methyl-cyclohexyl-methylazanium.
| Compound Name | [2-[[2-(2-chloro-5-nitroanilino)-2-oxoethyl]amino]phenyl]methyl-cyclohexyl-methylazanium |
|---|---|
| PubChem CID | 2420495 |
| Molecular Formula | C22H28ClN4O3+ |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [2-[[2-(2-chloro-5-nitroanilino)-2-oxoethyl]amino]phenyl]methyl-cyclohexyl-methylazanium |
| SMILES | C[NH+](Cc1ccccc1NCC(=O)Nc1cc([N+](=O)[O-])ccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C22H27ClN4O3/c1-26(17-8-3-2-4-9-17)15-16-7-5-6-10-20(16)24-14-22(28)25-21-13-18(27(29)30)11-12-19(21)23/h5-7,10-13,17,24H,2-4,8-9,14-15H2,1H3,(H,25,28)/p+1 |
| InChIKey | CLXXPSBMTTWLKD-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|