C24H37N3O3 — CID 155692959
cycloheptane;ethyl 5-cyano-3-methyl-2-[2-(methylamino)pentanoylamino]benzoate (PubChem CID 155692959) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is cycloheptane;ethyl 5-cyano-3-methyl-2-[2-(methylamino)pentanoylamino]benzoate.
| Compound Name | cycloheptane;ethyl 5-cyano-3-methyl-2-[2-(methylamino)pentanoylamino]benzoate |
|---|---|
| PubChem CID | 155692959 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | cycloheptane;ethyl 5-cyano-3-methyl-2-[2-(methylamino)pentanoylamino]benzoate |
| SMILES | C1CCCCCC1.CCCC(NC)C(=O)Nc1c(C)cc(C#N)cc1C(=O)OCC |
| InChI | InChI=1S/C17H23N3O3.C7H14/c1-5-7-14(19-4)16(21)20-15-11(3)8-12(10-18)9-13(15)17(22)23-6-2;1-2-4-6-7-5-3-1/h8-9,14,19H,5-7H2,1-4H3,(H,20,21);1-7H2 |
| InChIKey | UXMHDIBNTAVLPY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |