C20H33N2O2Y+ — CID 161000535
2-(1-ethylazepan-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)propanamide;yttrium (PubChem CID 161000535) has the molecular formula C20H33N2O2Y+ and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-(1-ethylazepan-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)propanamide;yttrium.
| Compound Name | 2-(1-ethylazepan-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)propanamide;yttrium |
|---|---|
| PubChem CID | 161000535 |
| Molecular Formula | C20H33N2O2Y+ |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-(1-ethylazepan-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)propanamide;yttrium |
| SMILES | CC[N+]1(C(C)C(=O)Nc2c(C)cc(OC)cc2C)CCCCCC1.[Y] |
| InChI | InChI=1S/C20H32N2O2.Y/c1-6-22(11-9-7-8-10-12-22)17(4)20(23)21-19-15(2)13-18(24-5)14-16(19)3;/h13-14,17H,6-12H2,1-5H3;/p+1 |
| InChIKey | KZBHKJCQRDWFDR-UHFFFAOYSA-O |
| XLogP | 4.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|