C19H28N3OY+ — CID 161223193
2-(1-ethylpyrrolidin-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)butanamide;yttrium (PubChem CID 161223193) has the molecular formula C19H28N3OY+ and a molecular weight of 403.36 g/mol. Its IUPAC name is 2-(1-ethylpyrrolidin-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)butanamide;yttrium.
| Compound Name | 2-(1-ethylpyrrolidin-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)butanamide;yttrium |
|---|---|
| PubChem CID | 161223193 |
| Molecular Formula | C19H28N3OY+ |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-(1-ethylpyrrolidin-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)butanamide;yttrium |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C(CC)[N+]2(CC)CCCC2)c(C)c1.[Y] |
| InChI | InChI=1S/C19H27N3O.Y/c1-6-17(22(7-2)10-8-9-11-22)19(23)21-18-14(3)12-16(20-5)13-15(18)4;/h12-13,17H,6-11H2,1-4H3;/p+1 |
| InChIKey | ZGGYWUGVUXPYNG-UHFFFAOYSA-O |
| XLogP | 4.20 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|