C26H38FN2OY+ — CID 158460729
2-(1-ethylpiperidin-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)butanamide;toluene;yttrium (PubChem CID 158460729) has the molecular formula C26H38FN2OY+ and a molecular weight of 502.51 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)butanamide;toluene;yttrium.
| Compound Name | 2-(1-ethylpiperidin-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)butanamide;toluene;yttrium |
|---|---|
| PubChem CID | 158460729 |
| Molecular Formula | C26H38FN2OY+ |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 2-(1-ethylpiperidin-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)butanamide;toluene;yttrium |
| SMILES | CCC(C(=O)Nc1c(C)cc(F)cc1C)[N+]1(CC)CCCCC1.Cc1ccccc1.[Y] |
| InChI | InChI=1S/C19H29FN2O.C7H8.Y/c1-5-17(22(6-2)10-8-7-9-11-22)19(23)21-18-14(3)12-16(20)13-15(18)4;1-7-5-3-2-4-6-7;/h12-13,17H,5-11H2,1-4H3;2-6H,1H3;/p+1 |
| InChIKey | AHKRDVBDPFXOHU-UHFFFAOYSA-O |
| XLogP | 6.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|