C24H32FN2O+ — CID 155615028
N-(2,6-dimethylphenyl)-2-[1-[(2-fluorophenyl)methyl]piperidin-1-ium-1-yl]butanamide (PubChem CID 155615028) has the molecular formula C24H32FN2O+ and a molecular weight of 383.53 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[1-[(2-fluorophenyl)methyl]piperidin-1-ium-1-yl]butanamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[1-[(2-fluorophenyl)methyl]piperidin-1-ium-1-yl]butanamide |
|---|---|
| PubChem CID | 155615028 |
| Molecular Formula | C24H32FN2O+ |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[1-[(2-fluorophenyl)methyl]piperidin-1-ium-1-yl]butanamide |
| SMILES | CCC(C(=O)Nc1c(C)cccc1C)[N+]1(Cc2ccccc2F)CCCCC1 |
| InChI | InChI=1S/C24H31FN2O/c1-4-22(24(28)26-23-18(2)11-10-12-19(23)3)27(15-8-5-9-16-27)17-20-13-6-7-14-21(20)25/h6-7,10-14,22H,4-5,8-9,15-17H2,1-3H3/p+1 |
| InChIKey | QVYAIUDBLGVDKI-UHFFFAOYSA-O |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|