C26H33N2O5+ — CID 170269593
methyl 3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)pyrrolidin-1-ium-1-yl]butanoylamino]benzoate (PubChem CID 170269593) has the molecular formula C26H33N2O5+ and a molecular weight of 453.56 g/mol. Its IUPAC name is methyl 3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)pyrrolidin-1-ium-1-yl]butanoylamino]benzoate.
| Compound Name | methyl 3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)pyrrolidin-1-ium-1-yl]butanoylamino]benzoate |
|---|---|
| PubChem CID | 170269593 |
| Molecular Formula | C26H33N2O5+ |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | methyl 3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)pyrrolidin-1-ium-1-yl]butanoylamino]benzoate |
| SMILES | CCC(C(=O)Nc1c(C)cccc1C(=O)OC)[N+]1(CC(=O)OCc2ccccc2)CCCC1 |
| InChI | InChI=1S/C26H32N2O5/c1-4-22(25(30)27-24-19(2)11-10-14-21(24)26(31)32-3)28(15-8-9-16-28)17-23(29)33-18-20-12-6-5-7-13-20/h5-7,10-14,22H,4,8-9,15-18H2,1-3H3/p+1 |
| InChIKey | UOGACEASSGIRQR-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|