C49H66N4O7 — CID 155100257
bis(N-(2,6-dimethylphenyl)-2-[1-[(3-hydroxyphenyl)methyl]piperidin-1-ium-1-yl]butanamide);carbonate (PubChem CID 155100257) has the molecular formula C49H66N4O7 and a molecular weight of 823.09 g/mol. Its IUPAC name is bis(N-(2,6-dimethylphenyl)-2-[1-[(3-hydroxyphenyl)methyl]piperidin-1-ium-1-yl]butanamide);carbonate.
| Compound Name | bis(N-(2,6-dimethylphenyl)-2-[1-[(3-hydroxyphenyl)methyl]piperidin-1-ium-1-yl]butanamide);carbonate |
|---|---|
| PubChem CID | 155100257 |
| Molecular Formula | C49H66N4O7 |
| Molecular Weight | 823.09 g/mol |
| Exact Mass | 822.49 |
| IUPAC Name | bis(N-(2,6-dimethylphenyl)-2-[1-[(3-hydroxyphenyl)methyl]piperidin-1-ium-1-yl]butanamide);carbonate |
| SMILES | CCC(C(=O)Nc1c(C)cccc1C)[N+]1(Cc2cccc(O)c2)CCCCC1.CCC(C(=O)Nc1c(C)cccc1C)[N+]1(Cc2cccc(O)c2)CCCCC1.O=C([O-])[O-] |
| InChI | InChI=1S/2C24H32N2O2.CH2O3/c2*1-4-22(24(28)25-23-18(2)10-8-11-19(23)3)26(14-6-5-7-15-26)17-20-12-9-13-21(27)16-20;2-1(3)4/h2*8-13,16,22H,4-7,14-15,17H2,1-3H3,(H-,25,27,28);(H2,2,3,4) |
| InChIKey | KUOQZTMVLFMFHU-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 161.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.09 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|