C25H32N3O+ — CID 155615027
2-[1-[(3-cyanophenyl)methyl]piperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)butanamide (PubChem CID 155615027) has the molecular formula C25H32N3O+ and a molecular weight of 390.55 g/mol. Its IUPAC name is 2-[1-[(3-cyanophenyl)methyl]piperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)butanamide.
| Compound Name | 2-[1-[(3-cyanophenyl)methyl]piperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 155615027 |
| Molecular Formula | C25H32N3O+ |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 2-[1-[(3-cyanophenyl)methyl]piperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)butanamide |
| SMILES | CCC(C(=O)Nc1c(C)cccc1C)[N+]1(Cc2cccc(C#N)c2)CCCCC1 |
| InChI | InChI=1S/C25H31N3O/c1-4-23(25(29)27-24-19(2)10-8-11-20(24)3)28(14-6-5-7-15-28)18-22-13-9-12-21(16-22)17-26/h8-13,16,23H,4-7,14-15,18H2,1-3H3/p+1 |
| InChIKey | YKTHKEHBICDOMU-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|