C26H33N2OY+ — CID 159999633
4-[[1-[1-(2,6-dimethylphenyl)-2-oxopentan-3-yl]piperidin-1-ium-1-yl]methyl]benzonitrile;yttrium (PubChem CID 159999633) has the molecular formula C26H33N2OY+ and a molecular weight of 478.47 g/mol. Its IUPAC name is 4-[[1-[1-(2,6-dimethylphenyl)-2-oxopentan-3-yl]piperidin-1-ium-1-yl]methyl]benzonitrile;yttrium.
| Compound Name | 4-[[1-[1-(2,6-dimethylphenyl)-2-oxopentan-3-yl]piperidin-1-ium-1-yl]methyl]benzonitrile;yttrium |
|---|---|
| PubChem CID | 159999633 |
| Molecular Formula | C26H33N2OY+ |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 4-[[1-[1-(2,6-dimethylphenyl)-2-oxopentan-3-yl]piperidin-1-ium-1-yl]methyl]benzonitrile;yttrium |
| SMILES | CCC(C(=O)Cc1c(C)cccc1C)[N+]1(Cc2ccc(C#N)cc2)CCCCC1.[Y] |
| InChI | InChI=1S/C26H33N2O.Y/c1-4-25(26(29)17-24-20(2)9-8-10-21(24)3)28(15-6-5-7-16-28)19-23-13-11-22(18-27)12-14-23;/h8-14,25H,4-7,15-17,19H2,1-3H3;/q+1; |
| InChIKey | HKPIORZZYAPHDT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|