C18H28NO+ — CID 159106976
1-(2,6-dimethylphenyl)-3-(1-methylpyrrolidin-1-ium-1-yl)pentan-2-one (PubChem CID 159106976) has the molecular formula C18H28NO+ and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(1-methylpyrrolidin-1-ium-1-yl)pentan-2-one.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(1-methylpyrrolidin-1-ium-1-yl)pentan-2-one |
|---|---|
| PubChem CID | 159106976 |
| Molecular Formula | C18H28NO+ |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(1-methylpyrrolidin-1-ium-1-yl)pentan-2-one |
| SMILES | CCC(C(=O)Cc1c(C)cccc1C)[N+]1(C)CCCC1 |
| InChI | InChI=1S/C18H28NO/c1-5-17(19(4)11-6-7-12-19)18(20)13-16-14(2)9-8-10-15(16)3/h8-10,17H,5-7,11-13H2,1-4H3/q+1 |
| InChIKey | KDZVZHGFNMNYDM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|