C17H23N2O+ — CID 159043277
1-(2,6-dimethylphenyl)-3-(3-methylimidazol-3-ium-1-yl)pentan-2-one (PubChem CID 159043277) has the molecular formula C17H23N2O+ and a molecular weight of 271.38 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(3-methylimidazol-3-ium-1-yl)pentan-2-one.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(3-methylimidazol-3-ium-1-yl)pentan-2-one |
|---|---|
| PubChem CID | 159043277 |
| Molecular Formula | C17H23N2O+ |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(3-methylimidazol-3-ium-1-yl)pentan-2-one |
| SMILES | CCC(C(=O)Cc1c(C)cccc1C)n1cc[n+](C)c1 |
| InChI | InChI=1S/C17H23N2O/c1-5-16(19-10-9-18(4)12-19)17(20)11-15-13(2)7-6-8-14(15)3/h6-10,12,16H,5,11H2,1-4H3/q+1 |
| InChIKey | JXZYFAOUNWBKMA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|