C18H23BrN2O3 — CID 160973705
ethyl 2-[3-[3-(2,6-dimethylphenyl)-2-oxopropyl]imidazol-3-ium-1-yl]acetate bromide (PubChem CID 160973705) has the molecular formula C18H23BrN2O3 and a molecular weight of 395.30 g/mol. Its IUPAC name is ethyl 2-[3-[3-(2,6-dimethylphenyl)-2-oxopropyl]imidazol-3-ium-1-yl]acetate bromide.
| Compound Name | ethyl 2-[3-[3-(2,6-dimethylphenyl)-2-oxopropyl]imidazol-3-ium-1-yl]acetate bromide |
|---|---|
| PubChem CID | 160973705 |
| Molecular Formula | C18H23BrN2O3 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | ethyl 2-[3-[3-(2,6-dimethylphenyl)-2-oxopropyl]imidazol-3-ium-1-yl]acetate bromide |
| SMILES | CCOC(=O)Cn1cc[n+](CC(=O)Cc2c(C)cccc2C)c1.[Br-] |
| InChI | InChI=1S/C18H23N2O3.BrH/c1-4-23-18(22)12-20-9-8-19(13-20)11-16(21)10-17-14(2)6-5-7-15(17)3;/h5-9,13H,4,10-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DMLZHWGDGWCGLJ-UHFFFAOYSA-M |
| XLogP | -1.23 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|