C18H25N2O+ — CID 158305612
1-(2,6-dimethylphenyl)-3-(3-methyl-2-propylpyrazol-1-ium-1-yl)propan-2-one (PubChem CID 158305612) has the molecular formula C18H25N2O+ and a molecular weight of 285.41 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(3-methyl-2-propylpyrazol-1-ium-1-yl)propan-2-one.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(3-methyl-2-propylpyrazol-1-ium-1-yl)propan-2-one |
|---|---|
| PubChem CID | 158305612 |
| Molecular Formula | C18H25N2O+ |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(3-methyl-2-propylpyrazol-1-ium-1-yl)propan-2-one |
| SMILES | CCCn1c(C)cc[n+]1CC(=O)Cc1c(C)cccc1C |
| InChI | InChI=1S/C18H25N2O/c1-5-10-20-16(4)9-11-19(20)13-17(21)12-18-14(2)7-6-8-15(18)3/h6-9,11H,5,10,12-13H2,1-4H3/q+1 |
| InChIKey | OIZXBNFNPKVUDX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|