C19H21N2O+ — CID 159619482
1-(2,6-dimethylphenyl)-3-(1-methylindazol-2-ium-2-yl)propan-2-one (PubChem CID 159619482) has the molecular formula C19H21N2O+ and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(1-methylindazol-2-ium-2-yl)propan-2-one.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(1-methylindazol-2-ium-2-yl)propan-2-one |
|---|---|
| PubChem CID | 159619482 |
| Molecular Formula | C19H21N2O+ |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(1-methylindazol-2-ium-2-yl)propan-2-one |
| SMILES | Cc1cccc(C)c1CC(=O)C[n+]1cc2ccccc2n1C |
| InChI | InChI=1S/C19H21N2O/c1-14-7-6-8-15(2)18(14)11-17(22)13-21-12-16-9-4-5-10-19(16)20(21)3/h4-10,12H,11,13H2,1-3H3/q+1 |
| InChIKey | PLEKRFAMZGVQMX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|