C24H26BrNO — CID 159353810
1-(2,6-dimethylphenyl)-3-(2,6-dimethyl-3-phenylpyridin-1-ium-1-yl)propan-2-one bromide (PubChem CID 159353810) has the molecular formula C24H26BrNO and a molecular weight of 424.38 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(2,6-dimethyl-3-phenylpyridin-1-ium-1-yl)propan-2-one bromide.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(2,6-dimethyl-3-phenylpyridin-1-ium-1-yl)propan-2-one bromide |
|---|---|
| PubChem CID | 159353810 |
| Molecular Formula | C24H26BrNO |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(2,6-dimethyl-3-phenylpyridin-1-ium-1-yl)propan-2-one bromide |
| SMILES | Cc1cccc(C)c1CC(=O)C[n+]1c(C)ccc(-c2ccccc2)c1C.[Br-] |
| InChI | InChI=1S/C24H26NO.BrH/c1-17-9-8-10-18(2)24(17)15-22(26)16-25-19(3)13-14-23(20(25)4)21-11-6-5-7-12-21;/h5-14H,15-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | NTNBCPAXXSBZAX-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|