C22H21BrFNO — CID 159447069
1-(2,6-dimethylphenyl)-3-(5-fluoro-2-phenylpyridin-1-ium-1-yl)propan-2-one bromide (PubChem CID 159447069) has the molecular formula C22H21BrFNO and a molecular weight of 414.32 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(5-fluoro-2-phenylpyridin-1-ium-1-yl)propan-2-one bromide.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(5-fluoro-2-phenylpyridin-1-ium-1-yl)propan-2-one bromide |
|---|---|
| PubChem CID | 159447069 |
| Molecular Formula | C22H21BrFNO |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(5-fluoro-2-phenylpyridin-1-ium-1-yl)propan-2-one bromide |
| SMILES | Cc1cccc(C)c1CC(=O)C[n+]1cc(F)ccc1-c1ccccc1.[Br-] |
| InChI | InChI=1S/C22H21FNO.BrH/c1-16-7-6-8-17(2)21(16)13-20(25)15-24-14-19(23)11-12-22(24)18-9-4-3-5-10-18;/h3-12,14H,13,15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NGUCSZOXNNLDOH-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|