C18H18F3N2O2+ — CID 159964110
1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-3-(trifluoromethyl)pyridin-1-ium-4-carboxamide (PubChem CID 159964110) has the molecular formula C18H18F3N2O2+ and a molecular weight of 351.35 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-3-(trifluoromethyl)pyridin-1-ium-4-carboxamide.
| Compound Name | 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-3-(trifluoromethyl)pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 159964110 |
| Molecular Formula | C18H18F3N2O2+ |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-3-(trifluoromethyl)pyridin-1-ium-4-carboxamide |
| SMILES | Cc1cccc(C)c1CC(=O)C[n+]1ccc(C(N)=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O2/c1-11-4-3-5-12(2)15(11)8-13(24)9-23-7-6-14(17(22)25)16(10-23)18(19,20)21/h3-7,10H,8-9H2,1-2H3,(H-,22,25)/p+1 |
| InChIKey | ODRYWQRRWPFMLN-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 64.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|