C26H24BrNO — CID 158433478
1-(2,6-dimethylphenyl)-3-(4-phenylisoquinolin-2-ium-2-yl)propan-2-one bromide (PubChem CID 158433478) has the molecular formula C26H24BrNO and a molecular weight of 446.39 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(4-phenylisoquinolin-2-ium-2-yl)propan-2-one bromide.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(4-phenylisoquinolin-2-ium-2-yl)propan-2-one bromide |
|---|---|
| PubChem CID | 158433478 |
| Molecular Formula | C26H24BrNO |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(4-phenylisoquinolin-2-ium-2-yl)propan-2-one bromide |
| SMILES | Cc1cccc(C)c1CC(=O)C[n+]1cc(-c2ccccc2)c2ccccc2c1.[Br-] |
| InChI | InChI=1S/C26H24NO.BrH/c1-19-9-8-10-20(2)25(19)15-23(28)17-27-16-22-13-6-7-14-24(22)26(18-27)21-11-4-3-5-12-21;/h3-14,16,18H,15,17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HBOCEAKPJPWSIR-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|