C17H17N2OY+ — CID 160919560
1-(4-isocyano-2,6-dimethylphenyl)-3-pyridin-1-ium-1-ylpropan-2-one;yttrium (PubChem CID 160919560) has the molecular formula C17H17N2OY+ and a molecular weight of 354.24 g/mol. Its IUPAC name is 1-(4-isocyano-2,6-dimethylphenyl)-3-pyridin-1-ium-1-ylpropan-2-one;yttrium.
| Compound Name | 1-(4-isocyano-2,6-dimethylphenyl)-3-pyridin-1-ium-1-ylpropan-2-one;yttrium |
|---|---|
| PubChem CID | 160919560 |
| Molecular Formula | C17H17N2OY+ |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-(4-isocyano-2,6-dimethylphenyl)-3-pyridin-1-ium-1-ylpropan-2-one;yttrium |
| SMILES | [C-]#[N+]c1cc(C)c(CC(=O)C[n+]2ccccc2)c(C)c1.[Y] |
| InChI | InChI=1S/C17H17N2O.Y/c1-13-9-15(18-3)10-14(2)17(13)11-16(20)12-19-7-5-4-6-8-19;/h4-10H,11-12H2,1-2H3;/q+1; |
| InChIKey | RIZVJBAGLXZGMA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|