C31H28N2OPY+ — CID 161152507
[1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-triphenylphosphanium;yttrium (PubChem CID 161152507) has the molecular formula C31H28N2OPY+ and a molecular weight of 564.46 g/mol. Its IUPAC name is [1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-triphenylphosphanium;yttrium.
| Compound Name | [1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-triphenylphosphanium;yttrium |
|---|---|
| PubChem CID | 161152507 |
| Molecular Formula | C31H28N2OPY+ |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | [1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-triphenylphosphanium;yttrium |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C2([P+](c3ccccc3)(c3ccccc3)c3ccccc3)CC2)c(C)c1.[Y] |
| InChI | InChI=1S/C31H27N2OP.Y/c1-23-21-25(32-3)22-24(2)29(23)33-30(34)31(19-20-31)35(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28;/h4-18,21-22H,19-20H2,1-2H3;/p+1 |
| InChIKey | KDTHKQGHGPBWSN-UHFFFAOYSA-O |
| XLogP | 6.32 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|