C27H35N3O2P+ — CID 159789603
[2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-[1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]phosphanium (PubChem CID 159789603) has the molecular formula C27H35N3O2P+ and a molecular weight of 464.57 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-[1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]phosphanium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-[1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]phosphanium |
|---|---|
| PubChem CID | 159789603 |
| Molecular Formula | C27H35N3O2P+ |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-[1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]phosphanium |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C2([P+](CC)(CC)CC(=O)Nc3c(C)cccc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C27H34N3O2P/c1-8-33(9-2,17-23(31)29-24-18(3)11-10-12-19(24)4)27(13-14-27)26(32)30-25-20(5)15-22(28-7)16-21(25)6/h10-12,15-16H,8-9,13-14,17H2,1-6H3,(H-,29,30,31,32)/p+1 |
| InChIKey | CIIVPYUTEZWDLI-UHFFFAOYSA-O |
| XLogP | 6.64 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|