C26H42N2OPY+ — CID 159263942
tributyl-[1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]phosphanium;yttrium (PubChem CID 159263942) has the molecular formula C26H42N2OPY+ and a molecular weight of 518.52 g/mol. Its IUPAC name is tributyl-[1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]phosphanium;yttrium.
| Compound Name | tributyl-[1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]phosphanium;yttrium |
|---|---|
| PubChem CID | 159263942 |
| Molecular Formula | C26H42N2OPY+ |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | tributyl-[1-[(4-isocyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]phosphanium;yttrium |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C2([P+](CCCC)(CCCC)CCCC)CCC2)c(C)c1.[Y] |
| InChI | InChI=1S/C26H41N2OP.Y/c1-7-10-16-30(17-11-8-2,18-12-9-3)26(14-13-15-26)25(29)28-24-21(4)19-23(27-6)20-22(24)5;/h19-20H,7-18H2,1-5H3;/p+1 |
| InChIKey | XBRVDCNKYSMAFG-UHFFFAOYSA-O |
| XLogP | 8.13 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|