C19H29FNOP — CID 158204079
diethyl-ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]phosphanium (PubChem CID 158204079) has the molecular formula C19H29FNOP and a molecular weight of 337.42 g/mol. Its IUPAC name is diethyl-ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]phosphanium.
| Compound Name | diethyl-ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]phosphanium |
|---|---|
| PubChem CID | 158204079 |
| Molecular Formula | C19H29FNOP |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | diethyl-ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]phosphanium |
| SMILES | C[CH-][P+](CC)(CC)C1(C(=O)Nc2c(C)cc(F)cc2C)CCC1 |
| InChI | InChI=1S/C19H29FNOP/c1-6-23(7-2,8-3)19(10-9-11-19)18(22)21-17-14(4)12-16(20)13-15(17)5/h6,12-13H,7-11H2,1-5H3,(H,21,22) |
| InChIKey | PNRWESGDYPBHSW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|