C20H30FN2O+ — CID 155692399
N-(4-fluoro-2,6-dimethylphenyl)-1-(1-methylazepan-1-ium-1-yl)cyclobutane-1-carboxamide (PubChem CID 155692399) has the molecular formula C20H30FN2O+ and a molecular weight of 333.47 g/mol. Its IUPAC name is N-(4-fluoro-2,6-dimethylphenyl)-1-(1-methylazepan-1-ium-1-yl)cyclobutane-1-carboxamide.
| Compound Name | N-(4-fluoro-2,6-dimethylphenyl)-1-(1-methylazepan-1-ium-1-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 155692399 |
| Molecular Formula | C20H30FN2O+ |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N-(4-fluoro-2,6-dimethylphenyl)-1-(1-methylazepan-1-ium-1-yl)cyclobutane-1-carboxamide |
| SMILES | Cc1cc(F)cc(C)c1NC(=O)C1([N+]2(C)CCCCCC2)CCC1 |
| InChI | InChI=1S/C20H29FN2O/c1-15-13-17(21)14-16(2)18(15)22-19(24)20(9-8-10-20)23(3)11-6-4-5-7-12-23/h13-14H,4-12H2,1-3H3/p+1 |
| InChIKey | PUTCNVXMSQHBKY-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|