C19H30N3O+ — CID 155692272
1-(1,2-dimethylpyrazolidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclobutane-1-carboxamide (PubChem CID 155692272) has the molecular formula C19H30N3O+ and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-(1,2-dimethylpyrazolidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(1,2-dimethylpyrazolidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 155692272 |
| Molecular Formula | C19H30N3O+ |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 1-(1,2-dimethylpyrazolidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclobutane-1-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2([N+]3(C)CCCN3C)CCC2)c(C)c1 |
| InChI | InChI=1S/C19H29N3O/c1-14-12-15(2)17(16(3)13-14)20-18(23)19(8-6-9-19)22(5)11-7-10-21(22)4/h12-13H,6-11H2,1-5H3/p+1 |
| InChIKey | NRURVPIKSCQROO-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|