C20H31N2O+ — CID 159612889
1-(1-ethylpiperidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide (PubChem CID 159612889) has the molecular formula C20H31N2O+ and a molecular weight of 315.48 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(1-ethylpiperidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 159612889 |
| Molecular Formula | C20H31N2O+ |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-(1-ethylpiperidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC[N+]1(C2(C(=O)Nc3c(C)cc(C)cc3C)CC2)CCCCC1 |
| InChI | InChI=1S/C20H30N2O/c1-5-22(11-7-6-8-12-22)20(9-10-20)19(23)21-18-16(3)13-15(2)14-17(18)4/h13-14H,5-12H2,1-4H3/p+1 |
| InChIKey | ZKHNHMHDURCKHG-UHFFFAOYSA-O |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|