C29H37N2O5+ — CID 170269548
methyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate (PubChem CID 170269548) has the molecular formula C29H37N2O5+ and a molecular weight of 493.62 g/mol. Its IUPAC name is methyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 170269548 |
| Molecular Formula | C29H37N2O5+ |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | methyl 3,5-dimethyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(C)cc(C)c1NC(=O)C1([N+]2(CC(=O)OCc3ccccc3)CCCCCC2)CC1 |
| InChI | InChI=1S/C29H36N2O5/c1-21-17-22(2)26(24(18-21)27(33)35-3)30-28(34)29(13-14-29)31(15-9-4-5-10-16-31)19-25(32)36-20-23-11-7-6-8-12-23/h6-8,11-12,17-18H,4-5,9-10,13-16,19-20H2,1-3H3/p+1 |
| InChIKey | JBODUHRLRKYGIH-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|