C17H25FNOPY — CID 161293843
ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-methanidyl-methylphosphanium;yttrium (PubChem CID 161293843) has the molecular formula C17H25FNOPY and a molecular weight of 398.27 g/mol. Its IUPAC name is ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-methanidyl-methylphosphanium;yttrium.
| Compound Name | ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-methanidyl-methylphosphanium;yttrium |
|---|---|
| PubChem CID | 161293843 |
| Molecular Formula | C17H25FNOPY |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-methanidyl-methylphosphanium;yttrium |
| SMILES | [CH2-][P+](C)(CC)C1(C(=O)Nc2c(C)cc(F)cc2C)CCC1.[Y] |
| InChI | InChI=1S/C17H25FNOP.Y/c1-6-21(4,5)17(8-7-9-17)16(20)19-15-12(2)10-14(18)11-13(15)3;/h10-11H,4,6-9H2,1-3,5H3,(H,19,20); |
| InChIKey | VPIDTILWKPEBHE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|