C16H22FN2O3+ — CID 155693070
[1-[(4-fluoro-2-methoxycarbonyl-6-methylphenyl)carbamoyl]cyclobutyl]-dimethylazanium (PubChem CID 155693070) has the molecular formula C16H22FN2O3+ and a molecular weight of 309.36 g/mol. Its IUPAC name is [1-[(4-fluoro-2-methoxycarbonyl-6-methylphenyl)carbamoyl]cyclobutyl]-dimethylazanium.
| Compound Name | [1-[(4-fluoro-2-methoxycarbonyl-6-methylphenyl)carbamoyl]cyclobutyl]-dimethylazanium |
|---|---|
| PubChem CID | 155693070 |
| Molecular Formula | C16H22FN2O3+ |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [1-[(4-fluoro-2-methoxycarbonyl-6-methylphenyl)carbamoyl]cyclobutyl]-dimethylazanium |
| SMILES | COC(=O)c1cc(F)cc(C)c1NC(=O)C1([NH+](C)C)CCC1 |
| InChI | InChI=1S/C16H21FN2O3/c1-10-8-11(17)9-12(14(20)22-4)13(10)18-15(21)16(19(2)3)6-5-7-16/h8-9H,5-7H2,1-4H3,(H,18,21)/p+1 |
| InChIKey | RPNGPGWQQQBSJY-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |