C14H21FN2OS — CID 155692415
[1-(4-fluoro-2,6-dimethylanilino)-1-oxobutan-2-yl]-dimethyl-sulfidoazanium (PubChem CID 155692415) has the molecular formula C14H21FN2OS and a molecular weight of 284.40 g/mol. Its IUPAC name is [1-(4-fluoro-2,6-dimethylanilino)-1-oxobutan-2-yl]-dimethyl-sulfidoazanium.
| Compound Name | [1-(4-fluoro-2,6-dimethylanilino)-1-oxobutan-2-yl]-dimethyl-sulfidoazanium |
|---|---|
| PubChem CID | 155692415 |
| Molecular Formula | C14H21FN2OS |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [1-(4-fluoro-2,6-dimethylanilino)-1-oxobutan-2-yl]-dimethyl-sulfidoazanium |
| SMILES | CCC(C(=O)Nc1c(C)cc(F)cc1C)[N+](C)(C)[S-] |
| InChI | InChI=1S/C14H21FN2OS/c1-6-12(17(4,5)19)14(18)16-13-9(2)7-11(15)8-10(13)3/h7-8,12H,6H2,1-5H3,(H,16,18) |
| InChIKey | IUVBPTWMIBVXSO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|