C25H47FN2O — CID 155693316
ethane;N-(4-fluoro-2,6-dimethylphenyl)-2,3-dipropyloctanamide;methanamine (PubChem CID 155693316) has the molecular formula C25H47FN2O and a molecular weight of 410.66 g/mol. Its IUPAC name is ethane;N-(4-fluoro-2,6-dimethylphenyl)-2,3-dipropyloctanamide;methanamine.
| Compound Name | ethane;N-(4-fluoro-2,6-dimethylphenyl)-2,3-dipropyloctanamide;methanamine |
|---|---|
| PubChem CID | 155693316 |
| Molecular Formula | C25H47FN2O |
| Molecular Weight | 410.66 g/mol |
| Exact Mass | 410.37 |
| IUPAC Name | ethane;N-(4-fluoro-2,6-dimethylphenyl)-2,3-dipropyloctanamide;methanamine |
| SMILES | CC.CCCCCC(CCC)C(CCC)C(=O)Nc1c(C)cc(F)cc1C.CN |
| InChI | InChI=1S/C22H36FNO.C2H6.CH5N/c1-6-9-10-13-18(11-7-2)20(12-8-3)22(25)24-21-16(4)14-19(23)15-17(21)5;2*1-2/h14-15,18,20H,6-13H2,1-5H3,(H,24,25);1-2H3;2H2,1H3 |
| InChIKey | MDUYIRCAKZIRKT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|