C15H23FO — CID 106879533
1-(4-fluoro-2,6-dimethylphenyl)heptan-1-ol (PubChem CID 106879533) has the molecular formula C15H23FO and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-(4-fluoro-2,6-dimethylphenyl)heptan-1-ol.
| Compound Name | 1-(4-fluoro-2,6-dimethylphenyl)heptan-1-ol |
|---|---|
| PubChem CID | 106879533 |
| Molecular Formula | C15H23FO |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-(4-fluoro-2,6-dimethylphenyl)heptan-1-ol |
| SMILES | CCCCCCC(O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C15H23FO/c1-4-5-6-7-8-14(17)15-11(2)9-13(16)10-12(15)3/h9-10,14,17H,4-8H2,1-3H3 |
| InChIKey | JYKNTAQLPZWPAP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|