C10H13FO — CID 106880220
(1S)-1-(4-fluoro-2,6-dimethylphenyl)ethanol (PubChem CID 106880220) has the molecular formula C10H13FO and a molecular weight of 168.21 g/mol. Its IUPAC name is (1S)-1-(4-fluoro-2,6-dimethylphenyl)ethanol.
| Compound Name | (1S)-1-(4-fluoro-2,6-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 106880220 |
| Molecular Formula | C10H13FO |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (1S)-1-(4-fluoro-2,6-dimethylphenyl)ethanol |
| SMILES | Cc1cc(F)cc(C)c1[C@H](C)O |
| InChI | InChI=1S/C10H13FO/c1-6-4-9(11)5-7(2)10(6)8(3)12/h4-5,8,12H,1-3H3/t8-/m0/s1 |
| InChIKey | YYXPVWQRWUNPDZ-QMMMGPOBSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |