C13H20FN — CID 106877205
1-(4-fluoro-2,6-dimethylphenyl)-2-methylbutan-1-amine (PubChem CID 106877205) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-(4-fluoro-2,6-dimethylphenyl)-2-methylbutan-1-amine.
| Compound Name | 1-(4-fluoro-2,6-dimethylphenyl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 106877205 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-(4-fluoro-2,6-dimethylphenyl)-2-methylbutan-1-amine |
| SMILES | CCC(C)C(N)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C13H20FN/c1-5-8(2)13(15)12-9(3)6-11(14)7-10(12)4/h6-8,13H,5,15H2,1-4H3 |
| InChIKey | SMERNDIDEYAQDJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |